Difference between revisions of "DUDP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE == * common-name: ** melatonin * smiles: ** cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2)) * inchi-key: ** drlfmbdrbr...") |
(Created page with "Category:metabolite == Metabolite CPD1G-277 == * common-name: ** cerotoyl-coa * smiles: ** cccccccccccccccccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD1G-277 == |
* common-name: | * common-name: | ||
| − | ** | + | ** cerotoyl-coa |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccccccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fhlyyfpjdvywqh-cpigopahsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 1142.183 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN1G-4355]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cerotoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fhlyyfpjdvywqh-cpigopahsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=1142.183}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD1G-277
- common-name:
- cerotoyl-coa
- smiles:
- cccccccccccccccccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
- inchi-key:
- fhlyyfpjdvywqh-cpigopahsa-j
- molecular-weight:
- 1142.183
