Difference between revisions of "DUDP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05001 == * transcription-direction: ** negative * right-end-position: ** 124254 * left-end-position: ** 116058 * centisome-position: ** 12.018839...") |
(Created page with "Category:metabolite == Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE == * common-name: ** melatonin * smiles: ** cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2)) * inchi-key: ** drlfmbdrbr...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE == |
− | + | * common-name: | |
− | + | ** melatonin | |
− | + | * smiles: | |
− | + | ** cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2)) | |
− | * | + | * inchi-key: |
− | ** | + | ** drlfmbdrbrzale-uhfffaoysa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 232.282 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-11056]] | |
− | + | * [[RXN-11057]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | ** | + | {{#set: common-name=melatonin}} |
− | * | + | {{#set: inchi-key=inchikey=drlfmbdrbrzale-uhfffaoysa-n}} |
− | + | {{#set: molecular-weight=232.282}} | |
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:32, 18 December 2020
Contents
Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE
- common-name:
- melatonin
- smiles:
- cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2))
- inchi-key:
- drlfmbdrbrzale-uhfffaoysa-n
- molecular-weight:
- 232.282