Difference between revisions of "DUMP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CHITOBIOSE == * common-name: ** n,n'-diacetylchitobiose == Reaction(s) known to consume the compound == * RXN-12625 == Reaction(s) kn...") |
(Created page with "Category:metabolite == Metabolite DUMP == * common-name: ** dump * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** jsrljpsbldheio-shyzeuofs...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DUMP == |
* common-name: | * common-name: | ||
− | ** | + | ** dump |
+ | * smiles: | ||
+ | ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) | ||
+ | * inchi-key: | ||
+ | ** jsrljpsbldheio-shyzeuofsa-l | ||
+ | * molecular-weight: | ||
+ | ** 306.168 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[MDUMT]] |
+ | * [[RXN-14143]] | ||
+ | * [[THYMIDYLATESYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[DCMP-DEAMINASE-RXN]] |
− | * [[RXN- | + | * [[DUTNH]] |
+ | * [[DUTP-PYROP-RXN]] | ||
+ | * [[MDUMT]] | ||
+ | * [[RXN-14199]] | ||
+ | * [[RXN-14220]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dump}} |
+ | {{#set: inchi-key=inchikey=jsrljpsbldheio-shyzeuofsa-l}} | ||
+ | {{#set: molecular-weight=306.168}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite DUMP
- common-name:
- dump
- smiles:
- c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
- inchi-key:
- jsrljpsbldheio-shyzeuofsa-l
- molecular-weight:
- 306.168