Difference between revisions of "DUMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14278 == * common-name: ** (3r)-3-hydroxy-cerotoyl-coa * smiles: ** cccccccccccccccccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-...")
(Created page with "Category:metabolite == Metabolite DUMP == * common-name: ** dump * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** jsrljpsbldheio-shyzeuofs...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14278 ==
+
== Metabolite DUMP ==
 
* common-name:
 
* common-name:
** (3r)-3-hydroxy-cerotoyl-coa
+
** dump
 
* smiles:
 
* smiles:
** cccccccccccccccccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
+
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
 
* inchi-key:
 
* inchi-key:
** gbmjotouuwgtia-cslactsssa-j
+
** jsrljpsbldheio-shyzeuofsa-l
 
* molecular-weight:
 
* molecular-weight:
** 1158.182
+
** 306.168
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13305]]
+
* [[MDUMT]]
 +
* [[RXN-14143]]
 +
* [[THYMIDYLATESYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13301]]
+
* [[DCMP-DEAMINASE-RXN]]
 +
* [[DUTNH]]
 +
* [[DUTP-PYROP-RXN]]
 +
* [[MDUMT]]
 +
* [[RXN-14199]]
 +
* [[RXN-14220]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-3-hydroxy-cerotoyl-coa}}
+
{{#set: common-name=dump}}
{{#set: inchi-key=inchikey=gbmjotouuwgtia-cslactsssa-j}}
+
{{#set: inchi-key=inchikey=jsrljpsbldheio-shyzeuofsa-l}}
{{#set: molecular-weight=1158.182}}
+
{{#set: molecular-weight=306.168}}

Latest revision as of 11:12, 18 March 2021

Metabolite DUMP

  • common-name:
    • dump
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • jsrljpsbldheio-shyzeuofsa-l
  • molecular-weight:
    • 306.168

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality