Difference between revisions of "DUMP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PRECURSOR-Z == * common-name: ** cyclic pyranopterin phosphate * smiles: ** c1(op([o-])(=o)oc2(c1o[ch]3([ch](c(=o)2)nc4(=c(n3)n=c(n)nc(=o...") |
(Created page with "Category:metabolite == Metabolite CPD-20680 == * common-name: ** diadinoxanthin * smiles: ** cc(c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-20680 == |
* common-name: | * common-name: | ||
| − | ** | + | ** diadinoxanthin |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)cc(c)(o2)3) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** oghzcsinimwcsb-ghiqlmqgsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 582.865 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-19200]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-19202]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=diadinoxanthin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oghzcsinimwcsb-ghiqlmqgsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=582.865}} |
Revision as of 18:54, 14 January 2021
Contents
Metabolite CPD-20680
- common-name:
- diadinoxanthin
- smiles:
- cc(c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)cc(c)(o2)3)
- inchi-key:
- oghzcsinimwcsb-ghiqlmqgsa-n
- molecular-weight:
- 582.865
