Difference between revisions of "DUTP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE == * common-name: ** (2r,3s)-3-isopropylmalate * smiles: ** cc(c)c(c([o-])=o)c(c([o-])=o)o * inch...") |
(Created page with "Category:metabolite == Metabolite Dietary-retinyl-esters == * common-name: ** a dietary all-trans-retinyl ester == Reaction(s) known to consume the compound == * RXN-125...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Dietary-retinyl-esters == |
* common-name: | * common-name: | ||
| − | ** | + | ** a dietary all-trans-retinyl ester |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-12579]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a dietary all-trans-retinyl ester}} |
| − | |||
| − | |||
Revision as of 08:26, 15 March 2021
Contents
Metabolite Dietary-retinyl-esters
- common-name:
- a dietary all-trans-retinyl ester
