Difference between revisions of "DUTP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Dietary-retinyl-esters == * common-name: ** a dietary all-trans-retinyl ester == Reaction(s) known to consume the compound == * RXN-125...") |
(Created page with "Category:metabolite == Metabolite DUTP == * common-name: ** dutp * smiles: ** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DUTP == |
* common-name: | * common-name: | ||
| − | ** | + | ** dutp |
| + | * smiles: | ||
| + | ** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o | ||
| + | * inchi-key: | ||
| + | ** ahcymluzirlxaa-shyzeuofsa-j | ||
| + | * molecular-weight: | ||
| + | ** 464.112 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[DUTCP]] |
| + | * [[DUTNH]] | ||
| + | * [[DUTP-PYROP-RXN]] | ||
| + | * [[DUTUP]] | ||
| + | * [[RXN-14199]] | ||
| + | * [[RXN-14219]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ATDUD]] | ||
| + | * [[ATDUDm]] | ||
| + | * [[DUDPKIN-RXN]] | ||
| + | * [[RXN0-724]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dutp}} |
| + | {{#set: inchi-key=inchikey=ahcymluzirlxaa-shyzeuofsa-j}} | ||
| + | {{#set: molecular-weight=464.112}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite DUTP
- common-name:
- dutp
- smiles:
- c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
- inchi-key:
- ahcymluzirlxaa-shyzeuofsa-j
- molecular-weight:
- 464.112
