Difference between revisions of "DUTP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ06843 == * transcription-direction: ** negative * right-end-position: ** 52020 * left-end-position: ** 50653 * centisome-position: ** 68.52408...") |
(Created page with "Category:metabolite == Metabolite DUTP == * common-name: ** dutp * smiles: ** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DUTP == |
− | * | + | * common-name: |
− | ** | + | ** dutp |
− | * | + | * smiles: |
− | ** | + | ** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o |
− | * | + | * inchi-key: |
− | ** | + | ** ahcymluzirlxaa-shyzeuofsa-j |
− | * | + | * molecular-weight: |
− | ** | + | ** 464.112 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[DUTCP]] |
− | + | * [[DUTNH]] | |
− | * [[ | + | * [[DUTP-PYROP-RXN]] |
− | * | + | * [[DUTUP]] |
− | * | + | * [[RXN-14199]] |
− | * [[ | + | * [[RXN-14219]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[ATDUD]] |
− | {{#set: | + | * [[ATDUDm]] |
− | {{#set: | + | * [[DUDPKIN-RXN]] |
− | + | * [[RXN0-724]] | |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=dutp}} | |
− | + | {{#set: inchi-key=inchikey=ahcymluzirlxaa-shyzeuofsa-j}} | |
+ | {{#set: molecular-weight=464.112}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite DUTP
- common-name:
- dutp
- smiles:
- c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
- inchi-key:
- ahcymluzirlxaa-shyzeuofsa-j
- molecular-weight:
- 464.112