Difference between revisions of "DUTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06843 == * transcription-direction: ** negative * right-end-position: ** 52020 * left-end-position: ** 50653 * centisome-position: ** 68.52408...")
(Created page with "Category:metabolite == Metabolite DUTP == * common-name: ** dutp * smiles: ** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ06843 ==
+
== Metabolite DUTP ==
* transcription-direction:
+
* common-name:
** negative
+
** dutp
* right-end-position:
+
* smiles:
** 52020
+
** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
* left-end-position:
+
* inchi-key:
** 50653
+
** ahcymluzirlxaa-shyzeuofsa-j
* centisome-position:
+
* molecular-weight:
** 68.52408   
+
** 464.112
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[DUTCP]]
== Reaction(s) associated ==
+
* [[DUTNH]]
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
* [[DUTP-PYROP-RXN]]
** Category: [[annotation]]
+
* [[DUTUP]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14199]]
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
* [[RXN-14219]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ATDUD]]
{{#set: transcription-direction=negative}}
+
* [[ATDUDm]]
{{#set: right-end-position=52020}}
+
* [[DUDPKIN-RXN]]
{{#set: left-end-position=50653}}
+
* [[RXN0-724]]
{{#set: centisome-position=68.52408    }}
+
== Reaction(s) of unknown directionality ==
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: common-name=dutp}}
{{#set: nb reaction associated=2}}
+
{{#set: inchi-key=inchikey=ahcymluzirlxaa-shyzeuofsa-j}}
 +
{{#set: molecular-weight=464.112}}

Latest revision as of 11:13, 18 March 2021

Metabolite DUTP

  • common-name:
    • dutp
  • smiles:
    • c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
  • inchi-key:
    • ahcymluzirlxaa-shyzeuofsa-j
  • molecular-weight:
    • 464.112

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality