Difference between revisions of "DUTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P == * common-name: ** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate * smiles: ** c1(op([o-])...")
(Created page with "Category:metabolite == Metabolite DUTP == * common-name: ** dutp * smiles: ** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P ==
+
== Metabolite DUTP ==
 
* common-name:
 
* common-name:
** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate
+
** dutp
 
* smiles:
 
* smiles:
** c1(op([o-])([o-])=o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
+
** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
 
* inchi-key:
 
* inchi-key:
** uphpwxpnziozjl-kxxvrosksa-a
+
** ahcymluzirlxaa-shyzeuofsa-j
 
* molecular-weight:
 
* molecular-weight:
** 726.913
+
** 464.112
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.4.24-RXN]]
+
* [[DUTCP]]
* [[RXN-10964]]
+
* [[DUTNH]]
* [[RXN-10965]]
+
* [[DUTP-PYROP-RXN]]
* [[RXN-10979]]
+
* [[DUTUP]]
 +
* [[RXN-14199]]
 +
* [[RXN-14219]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.152-RXN]]
+
* [[ATDUD]]
* [[RXN-10965]]
+
* [[ATDUDm]]
 +
* [[DUDPKIN-RXN]]
 +
* [[RXN0-724]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate}}
+
{{#set: common-name=dutp}}
{{#set: inchi-key=inchikey=uphpwxpnziozjl-kxxvrosksa-a}}
+
{{#set: inchi-key=inchikey=ahcymluzirlxaa-shyzeuofsa-j}}
{{#set: molecular-weight=726.913}}
+
{{#set: molecular-weight=464.112}}

Latest revision as of 11:13, 18 March 2021

Metabolite DUTP

  • common-name:
    • dutp
  • smiles:
    • c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
  • inchi-key:
    • ahcymluzirlxaa-shyzeuofsa-j
  • molecular-weight:
    • 464.112

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality