Difference between revisions of "DUTP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P == * common-name: ** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate * smiles: ** c1(op([o-])...") |
(Created page with "Category:metabolite == Metabolite DUTP == * common-name: ** dutp * smiles: ** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DUTP == |
* common-name: | * common-name: | ||
− | ** | + | ** dutp |
* smiles: | * smiles: | ||
− | ** | + | ** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ahcymluzirlxaa-shyzeuofsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 464.112 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DUTCP]] |
− | * [[ | + | * [[DUTNH]] |
− | * [[RXN- | + | * [[DUTP-PYROP-RXN]] |
− | * [[RXN- | + | * [[DUTUP]] |
+ | * [[RXN-14199]] | ||
+ | * [[RXN-14219]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ATDUD]] |
− | * [[ | + | * [[ATDUDm]] |
+ | * [[DUDPKIN-RXN]] | ||
+ | * [[RXN0-724]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dutp}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ahcymluzirlxaa-shyzeuofsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=464.112}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite DUTP
- common-name:
- dutp
- smiles:
- c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
- inchi-key:
- ahcymluzirlxaa-shyzeuofsa-j
- molecular-weight:
- 464.112