Difference between revisions of "DUTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00518 == * transcription-direction: ** negative * right-end-position: ** 175206 * left-end-position: ** 106081 * centisome-position: ** 18.682941...")
 
(Created page with "Category:metabolite == Metabolite DUTP == * common-name: ** dutp * smiles: ** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ00518 ==
+
== Metabolite DUTP ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** dutp
−
* right-end-position:
+
* smiles:
−
** 175206
+
** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 106081
+
** ahcymluzirlxaa-shyzeuofsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 18.682941   
+
** 464.112
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[DUTCP]]
−
== Reaction(s) associated ==
+
* [[DUTNH]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[DUTP-PYROP-RXN]]
−
* [[ATPASE-RXN]]
+
* [[DUTUP]]
−
** Category: [[annotation]]
+
* [[RXN-14199]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14219]]
−
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
* [[ATDUD]]
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[ATDUDm]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[DUDPKIN-RXN]]
−
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
+
* [[RXN0-724]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=dutp}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=ahcymluzirlxaa-shyzeuofsa-j}}
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
{{#set: molecular-weight=464.112}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-11135]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12195]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12196]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5462]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6797]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6147]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-7539]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=175206}}
 
−
{{#set: left-end-position=106081}}
 
−
{{#set: centisome-position=18.682941    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=8}}
 
−
{{#set: nb pathway associated=7}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite DUTP

  • common-name:
    • dutp
  • smiles:
    • c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
  • inchi-key:
    • ahcymluzirlxaa-shyzeuofsa-j
  • molecular-weight:
    • 464.112

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DUTP&oldid=137586"