Difference between revisions of "DUTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FERULOYL-COA == * common-name: ** feruloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=cc=1))cop(=o)(op(=o)(occ2(c...")
(Created page with "Category:metabolite == Metabolite DUTP == * common-name: ** dutp * smiles: ** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o * inchi-key: **...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FERULOYL-COA ==
+
== Metabolite DUTP ==
 
* common-name:
 
* common-name:
** feruloyl-coa
+
** dutp
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
 
* inchi-key:
 
* inchi-key:
** gbxzvjqqdajgso-nbxnmegssa-j
+
** ahcymluzirlxaa-shyzeuofsa-j
 
* molecular-weight:
 
* molecular-weight:
** 939.674
+
** 464.112
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1106]]
+
* [[DUTCP]]
 +
* [[DUTNH]]
 +
* [[DUTP-PYROP-RXN]]
 +
* [[DUTUP]]
 +
* [[RXN-14199]]
 +
* [[RXN-14219]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6.2.1.34-RXN]]
+
* [[ATDUD]]
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
+
* [[ATDUDm]]
 +
* [[DUDPKIN-RXN]]
 +
* [[RXN0-724]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=feruloyl-coa}}
+
{{#set: common-name=dutp}}
{{#set: inchi-key=inchikey=gbxzvjqqdajgso-nbxnmegssa-j}}
+
{{#set: inchi-key=inchikey=ahcymluzirlxaa-shyzeuofsa-j}}
{{#set: molecular-weight=939.674}}
+
{{#set: molecular-weight=464.112}}

Latest revision as of 11:13, 18 March 2021

Metabolite DUTP

  • common-name:
    • dutp
  • smiles:
    • c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
  • inchi-key:
    • ahcymluzirlxaa-shyzeuofsa-j
  • molecular-weight:
    • 464.112

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality