Difference between revisions of "DUTP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18295 == * transcription-direction: ** negative * right-end-position: ** 270885 * left-end-position: ** 266187 * centisome-position: ** 41.05898...") |
(Created page with "Category:metabolite == Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P == * common-name: ** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate * smiles: ** c1(op([o-])...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P == |
| − | * | + | * common-name: |
| − | ** | + | ** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate |
| − | * | + | * smiles: |
| − | ** | + | ** c1(op([o-])([o-])=o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** uphpwxpnziozjl-kxxvrosksa-a |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 726.913 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[2.7.4.24-RXN]] | |
| − | == Reaction(s) | + | * [[RXN-10964]] |
| − | * [[2.7. | + | * [[RXN-10965]] |
| − | * | + | * [[RXN-10979]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[2.7.1.152-RXN]] |
| − | + | * [[RXN-10965]] | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate}} | |
| − | * | + | {{#set: inchi-key=inchikey=uphpwxpnziozjl-kxxvrosksa-a}} |
| − | + | {{#set: molecular-weight=726.913}} | |
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
Revision as of 20:32, 18 December 2020
Contents
Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P
- common-name:
- 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate
- smiles:
- c1(op([o-])([o-])=o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
- inchi-key:
- uphpwxpnziozjl-kxxvrosksa-a
- molecular-weight:
- 726.913
