Difference between revisions of "DUTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P == * common-name: ** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate * smiles: ** c1(op([o-])...")
(Created page with "Category:metabolite == Metabolite CPD0-2232 == * common-name: ** (s)-3-hydroxyhexadecanoyl-coa * smiles: ** cccccccccccccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P ==
+
== Metabolite CPD0-2232 ==
 
* common-name:
 
* common-name:
** 1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate
+
** (s)-3-hydroxyhexadecanoyl-coa
 
* smiles:
 
* smiles:
** c1(op([o-])([o-])=o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
+
** cccccccccccccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
 
* inchi-key:
 
* inchi-key:
** uphpwxpnziozjl-kxxvrosksa-a
+
** dehlmtddpwdrdr-qqojfmbssa-j
 
* molecular-weight:
 
* molecular-weight:
** 726.913
+
** 1017.914
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.4.24-RXN]]
+
* [[ECOAH7h]]
* [[RXN-10964]]
+
* [[HACD7h]]
* [[RXN-10965]]
+
* [[RXN-14271]]
* [[RXN-10979]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.152-RXN]]
+
* [[ECOAH7h]]
* [[RXN-10965]]
+
* [[HACD7h]]
 +
* [[RXN-14271]]
 +
* [[RXN-14272]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate}}
+
{{#set: common-name=(s)-3-hydroxyhexadecanoyl-coa}}
{{#set: inchi-key=inchikey=uphpwxpnziozjl-kxxvrosksa-a}}
+
{{#set: inchi-key=inchikey=dehlmtddpwdrdr-qqojfmbssa-j}}
{{#set: molecular-weight=726.913}}
+
{{#set: molecular-weight=1017.914}}

Revision as of 14:55, 5 January 2021

Metabolite CPD0-2232

  • common-name:
    • (s)-3-hydroxyhexadecanoyl-coa
  • smiles:
    • cccccccccccccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
  • inchi-key:
    • dehlmtddpwdrdr-qqojfmbssa-j
  • molecular-weight:
    • 1017.914

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality