Difference between revisions of "Decanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE == * common-name: ** 2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine * smiles: ** c(nc=o...")
(Created page with "Category:metabolite == Metabolite Decanoyl-ACPs == * common-name: ** a decanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9531 * RXN-9652 == Reac...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE ==
+
== Metabolite Decanoyl-ACPs ==
 
* common-name:
 
* common-name:
** 2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine
+
** a decanoyl-[acp]
* smiles:
 
** c(nc=o)c(=[n+])nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
 
* inchi-key:
 
** pmcogcvkoaozqm-xvfcmesisa-m
 
* molecular-weight:
 
** 312.196
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AIRS-RXN]]
+
* [[RXN-9531]]
 +
* [[RXN-9652]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FGAMSYN-RXN]]
+
* [[RXN-9530]]
 +
* [[RXN-9660]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-(formamido)-n1-(5-phospho-β-d-ribosyl)acetamidine}}
+
{{#set: common-name=a decanoyl-[acp]}}
{{#set: inchi-key=inchikey=pmcogcvkoaozqm-xvfcmesisa-m}}
 
{{#set: molecular-weight=312.196}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite Decanoyl-ACPs

  • common-name:
    • a decanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a decanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.