Difference between revisions of "Decanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite XANTHINE == * common-name: ** xanthine * smiles: ** c12(nc(=o)nc(c=1n=cn2)=o) * inchi-key: ** lrfvtywoqmyalw-uhfffaoysa-n * molecular-wei...")
(Created page with "Category:metabolite == Metabolite CPD-12897 == * common-name: ** 7-methyl-3-oxooct-6-enoyl-coa * smiles: ** cc(c)=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite XANTHINE ==
+
== Metabolite CPD-12897 ==
 
* common-name:
 
* common-name:
** xanthine
+
** 7-methyl-3-oxooct-6-enoyl-coa
 
* smiles:
 
* smiles:
** c12(nc(=o)nc(c=1n=cn2)=o)
+
** cc(c)=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** lrfvtywoqmyalw-uhfffaoysa-n
+
** lpmixvanmseery-fueukbnzsa-j
 
* molecular-weight:
 
* molecular-weight:
** 152.112
+
** 915.695
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-901]]
+
* [[RXN-11917]]
* [[XANTHINE-OXIDASE-RXN]]
 
* [[XNDH]]
 
* [[XPPRT]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GUANINE-DEAMINASE-RXN]]
 
* [[RXN-7682]]
 
* [[RXN0-363]]
 
* [[RXN0-901]]
 
* [[XANDH]]
 
* [[XANTHOSINEPHOSPHORY-RXN]]
 
* [[XPPRT]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xanthine}}
+
{{#set: common-name=7-methyl-3-oxooct-6-enoyl-coa}}
{{#set: inchi-key=inchikey=lrfvtywoqmyalw-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=lpmixvanmseery-fueukbnzsa-j}}
{{#set: molecular-weight=152.112}}
+
{{#set: molecular-weight=915.695}}

Revision as of 14:54, 5 January 2021

Metabolite CPD-12897

  • common-name:
    • 7-methyl-3-oxooct-6-enoyl-coa
  • smiles:
    • cc(c)=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • lpmixvanmseery-fueukbnzsa-j
  • molecular-weight:
    • 915.695

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality