Difference between revisions of "Delta-14-steroids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-CITRULLINE == * common-name: ** l-citrulline * smiles: ** c(nc(n)=o)ccc([n+])c(=o)[o-] * inchi-key: ** rhgklrlohdjjdr-bypyzucnsa-n * mo...") |
(Created page with "Category:metabolite == Metabolite Delta-14-steroids == * common-name: ** a δ14steroid == Reaction(s) known to consume the compound == == Reaction(s) known to produce...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Delta-14-steroids == |
* common-name: | * common-name: | ||
− | ** | + | ** a δ14steroid |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-13961]] | |
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a δ14steroid}} |
− | |||
− |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite Delta-14-steroids
- common-name:
- a δ14steroid