Difference between revisions of "Delta-14-steroids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-313 RXN66-313] == * direction: ** left-to-right * common-name: ** 4α-carboxy-4β-me...")
(Created page with "Category:metabolite == Metabolite L-CITRULLINE == * common-name: ** l-citrulline * smiles: ** c(nc(n)=o)ccc([n+])c(=o)[o-] * inchi-key: ** rhgklrlohdjjdr-bypyzucnsa-n * mo...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-313 RXN66-313] ==
+
== Metabolite L-CITRULLINE ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol 3-dehydrogenase (decarboxylating)
+
** l-citrulline
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.1.1.170 ec-1.1.1.170]
+
** c(nc(n)=o)ccc([n+])c(=o)[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-4577]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-4578]][c] '''+''' 1 [[NADH-P-OR-NOP]][c]
+
** rhgklrlohdjjdr-bypyzucnsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ04782]]
+
** 175.187
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ARGSUCCINSYN-RXN]]
== Pathway(s) ==
+
* [[ORNCARBAMTRANSFER-RXN]]
* [[PWY-6074]], zymosterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6074 PWY-6074]
+
* [[RXN-13482]]
** '''6''' reactions found over '''14''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4]
+
* [[DIMETHYLARGININASE-RXN]]
** '''14''' reactions found over '''4''' reactions in the full pathway
+
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
* [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341]
+
* [[ORNCARBAMTRANSFER-RXN]]
** '''14''' reactions found over '''18''' reactions in the full pathway
+
* [[RXN-13482]]
== Reconstruction information  ==
+
* [[RXN-13565]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-7933]]
== External links  ==
+
== Reaction(s) of unknown directionality ==
* RHEA:
+
{{#set: common-name=l-citrulline}}
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=33448 33448]
+
{{#set: inchi-key=inchikey=rhgklrlohdjjdr-bypyzucnsa-n}}
* LIGAND-RXN:
+
{{#set: molecular-weight=175.187}}
** [http://www.genome.jp/dbget-bin/www_bget?R07494 R07494]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol 3-dehydrogenase (decarboxylating)}}
 
{{#set: ec-number=ec-1.1.1.170}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=3}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:38, 18 December 2020

Metabolite L-CITRULLINE

  • common-name:
    • l-citrulline
  • smiles:
    • c(nc(n)=o)ccc([n+])c(=o)[o-]
  • inchi-key:
    • rhgklrlohdjjdr-bypyzucnsa-n
  • molecular-weight:
    • 175.187

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality