Difference between revisions of "Delta-14-steroids"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-313 RXN66-313] == * direction: ** left-to-right * common-name: ** 4α-carboxy-4β-me...") |
(Created page with "Category:metabolite == Metabolite L-CITRULLINE == * common-name: ** l-citrulline * smiles: ** c(nc(n)=o)ccc([n+])c(=o)[o-] * inchi-key: ** rhgklrlohdjjdr-bypyzucnsa-n * mo...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite L-CITRULLINE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** l-citrulline |
− | * | + | * smiles: |
− | ** | + | ** c(nc(n)=o)ccc([n+])c(=o)[o-] |
− | = | + | * inchi-key: |
− | + | ** rhgklrlohdjjdr-bypyzucnsa-n | |
− | == | + | * molecular-weight: |
− | * | + | ** 175.187 |
− | * | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[ARGSUCCINSYN-RXN]] |
− | == | + | * [[ORNCARBAMTRANSFER-RXN]] |
− | * [[ | + | * [[RXN-13482]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * [[ | + | * [[DIMETHYLARGININASE-RXN]] |
− | + | * [[NITRIC-OXIDE-SYNTHASE-RXN]] | |
− | * [[ | + | * [[ORNCARBAMTRANSFER-RXN]] |
− | * | + | * [[RXN-13482]] |
− | + | * [[RXN-13565]] | |
− | + | * [[RXN-7933]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=l-citrulline}} | |
− | + | {{#set: inchi-key=inchikey=rhgklrlohdjjdr-bypyzucnsa-n}} | |
− | + | {{#set: molecular-weight=175.187}} | |
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Revision as of 20:38, 18 December 2020
Contents
Metabolite L-CITRULLINE
- common-name:
- l-citrulline
- smiles:
- c(nc(n)=o)ccc([n+])c(=o)[o-]
- inchi-key:
- rhgklrlohdjjdr-bypyzucnsa-n
- molecular-weight:
- 175.187