Difference between revisions of "Delta-14-steroids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15652 == * common-name: ** (3r)-hydroxy, 6-trans-tridecenoyl-coa * smiles: ** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...")
(Created page with "Category:metabolite == Metabolite beta-Gal-13-alpha-GalNac-R == * common-name: ** a type 3 histo-blood group antigen precursor disaccharide == Reaction(s) known to consume...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15652 ==
+
== Metabolite beta-Gal-13-alpha-GalNac-R ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy, 6-trans-tridecenoyl-coa
+
** a type 3 histo-blood group antigen precursor disaccharide
* smiles:
 
** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** adzjvtnixnsngu-ovqifrbasa-j
 
* molecular-weight:
 
** 973.818
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14786]]
+
* [[RXN-18266]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy, 6-trans-tridecenoyl-coa}}
+
{{#set: common-name=a type 3 histo-blood group antigen precursor disaccharide}}
{{#set: inchi-key=inchikey=adzjvtnixnsngu-ovqifrbasa-j}}
 
{{#set: molecular-weight=973.818}}
 

Revision as of 13:13, 14 January 2021

Metabolite beta-Gal-13-alpha-GalNac-R

  • common-name:
    • a type 3 histo-blood group antigen precursor disaccharide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality