Difference between revisions of "Delta7-Steroids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12929 == * common-name: ** 5α-cholesta-7,24-dien-3-one * inchi-key: ** lhhhzzhkuvlcji-iinkennysa-n * molecular-weight: ** 382.6...")
(Created page with "Category:metabolite == Metabolite CPD-10267 == * common-name: ** decanoyl-coa * smiles: ** cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12929 ==
+
== Metabolite CPD-10267 ==
 
* common-name:
 
* common-name:
** 5α-cholesta-7,24-dien-3-one
+
** decanoyl-coa
 +
* smiles:
 +
** cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** lhhhzzhkuvlcji-iinkennysa-n
+
** cnkjphsefdpydb-hsjnekgzsa-j
 
* molecular-weight:
 
* molecular-weight:
** 382.628
+
** 917.754
* smiles:
 
** cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@h]4(c1([c@@h]([c@]2(ccc(=o)c[c@h](cc=1)2)(c))cc[c@](c)34)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-21837]]
+
* [[RXN-13615]]
 +
* [[RXN-14274]]
 +
* [[RXN-9628]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13614]]
 +
* [[RXN-14274]]
 +
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10267/NAD//T2-DECENOYL-COA/NADH/PROTON.43.]]
 +
* [[TRANSENOYLCOARED-RXN-CPD-10267/NADP//T2-DECENOYL-COA/NADPH/PROTON.45.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5α-cholesta-7,24-dien-3-one}}
+
{{#set: common-name=decanoyl-coa}}
{{#set: inchi-key=inchikey=lhhhzzhkuvlcji-iinkennysa-n}}
+
{{#set: inchi-key=inchikey=cnkjphsefdpydb-hsjnekgzsa-j}}
{{#set: molecular-weight=382.628}}
+
{{#set: molecular-weight=917.754}}

Revision as of 15:27, 5 January 2021

Metabolite CPD-10267

  • common-name:
    • decanoyl-coa
  • smiles:
    • cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • cnkjphsefdpydb-hsjnekgzsa-j
  • molecular-weight:
    • 917.754

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality