Difference between revisions of "Demethylmenaquinols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LYS-tRNAs == * common-name: ** a trnalys == Reaction(s) known to consume the compound == * LYSINE--TRNA-LIGASE-RXN == Reaction(s) kno...")
(Created page with "Category:metabolite == Metabolite CPD-13851 == * common-name: ** 2-hydroxy-datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LYS-tRNAs ==
+
== Metabolite CPD-13851 ==
 
* common-name:
 
* common-name:
** a trnalys
+
** 2-hydroxy-datp
 +
* smiles:
 +
** c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
 +
* inchi-key:
 +
** uoacbprdwrdehj-kvqbguixsa-j
 +
* molecular-weight:
 +
** 503.152
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[LYSINE--TRNA-LIGASE-RXN]]
+
* [[RXN0-6957]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trnalys}}
+
{{#set: common-name=2-hydroxy-datp}}
 +
{{#set: inchi-key=inchikey=uoacbprdwrdehj-kvqbguixsa-j}}
 +
{{#set: molecular-weight=503.152}}

Revision as of 15:30, 5 January 2021

Metabolite CPD-13851

  • common-name:
    • 2-hydroxy-datp
  • smiles:
    • c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
  • inchi-key:
    • uoacbprdwrdehj-kvqbguixsa-j
  • molecular-weight:
    • 503.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality