Difference between revisions of "Deoxy-Ribonucleoside-Diphosphates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7953 == * common-name: ** torulene * smiles: ** cc(=cc=cc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)c)c)c)c)c * inchi-key...") |
(Created page with "Category:metabolite == Metabolite CPD-14706 == * common-name: ** 4-hydroxy-2-nonenal-[l-cys] conjugate * smiles: ** cccccc(o)c(cc=o)scc([n+])c(=o)[o-] * inchi-key: ** salp...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-14706 == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-hydroxy-2-nonenal-[l-cys] conjugate |
* smiles: | * smiles: | ||
− | ** | + | ** cccccc(o)c(cc=o)scc([n+])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** salpdushmtyyoh-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 277.378 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-13677]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-hydroxy-2-nonenal-[l-cys] conjugate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=salpdushmtyyoh-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=277.378}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite CPD-14706
- common-name:
- 4-hydroxy-2-nonenal-[l-cys] conjugate
- smiles:
- cccccc(o)c(cc=o)scc([n+])c(=o)[o-]
- inchi-key:
- salpdushmtyyoh-uhfffaoysa-n
- molecular-weight:
- 277.378
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "4-hydroxy-2-nonenal-[l-cys] conjugate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.