Difference between revisions of "Deoxy-Ribonucleoside-Diphosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19088 == * transcription-direction: ** positive * right-end-position: ** 206262 * left-end-position: ** 192051 * centisome-position: ** 16.834515...")
(Created page with "Category:metabolite == Metabolite CPD-15566 == * common-name: ** (2e,4e)-tetradecadienoyl-coa * smiles: ** cccccccccc=cc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ19088 ==
+
== Metabolite CPD-15566 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (2e,4e)-tetradecadienoyl-coa
−
* right-end-position:
+
* smiles:
−
** 206262
+
** cccccccccc=cc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 192051
+
** ulogshzmdlrqry-inbgbncrsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 16.834515   
+
** 969.83
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14715]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[APAPT]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=(2e,4e)-tetradecadienoyl-coa}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=ulogshzmdlrqry-inbgbncrsa-j}}
−
* [[RXN0-5217]]
+
{{#set: molecular-weight=969.83}}
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[SPERMIDINESYN-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[SPERMINE-SYNTHASE-RXN]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY0-1303]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[BSUBPOLYAMSYN-PWY]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[POLYAMINSYN3-PWY]]
 
−
** '''4''' reactions found over '''1''' reactions in the full pathway
 
−
* [[ARGSPECAT-PWY]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=206262}}
 
−
{{#set: left-end-position=192051}}
 
−
{{#set: centisome-position=16.834515    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:32, 18 December 2020

Metabolite CPD-15566

  • common-name:
    • (2e,4e)-tetradecadienoyl-coa
  • smiles:
    • cccccccccc=cc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • ulogshzmdlrqry-inbgbncrsa-j
  • molecular-weight:
    • 969.83

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Deoxy-Ribonucleoside-Diphosphates&oldid=46435"