Difference between revisions of "Deoxyhypusine-Synthase-Lysine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite REDUCED-MENAQUINONE == * common-name: ** menaquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c...")
(Created page with "Category:metabolite == Metabolite DIVINYL-PROTOCHLOROPHYLLIDE-A == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)=c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite REDUCED-MENAQUINONE ==
+
== Metabolite DIVINYL-PROTOCHLOROPHYLLIDE-A ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c9(c(c)=c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 
* common-name:
 
* common-name:
** menaquinol-8
+
** 3,8-divinyl protochlorophyllide a
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(=cc=cc=c1c(o)=2))
 
* inchi-key:
 
** oiezrvbfvpgodt-wqwycsgdsa-n
 
 
* molecular-weight:
 
* molecular-weight:
** 719.144
+
** 608.935
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-5285]]
 +
* [[RXN1F-72]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADOMET-DMK-METHYLTRANSFER-RXN]]
+
* [[RXN1F-72]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menaquinol-8}}
+
{{#set: common-name=3,8-divinyl protochlorophyllide a}}
{{#set: inchi-key=inchikey=oiezrvbfvpgodt-wqwycsgdsa-n}}
+
{{#set: molecular-weight=608.935}}
{{#set: molecular-weight=719.144}}
 

Revision as of 18:58, 14 January 2021

Metabolite DIVINYL-PROTOCHLOROPHYLLIDE-A

  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)=c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
  • common-name:
    • 3,8-divinyl protochlorophyllide a
  • molecular-weight:
    • 608.935

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality