Difference between revisions of "Dermatan-NAcGal-4-sulfates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11495 == * common-name: ** (2-hydroxyphenyl)acetate * smiles: ** c(=o)([o-])cc1(=c(o)c=cc=c1) * inchi-key: ** ccvyrrgzdbshfu-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite N-ACETYL-D-GLUCOSAMINE-16-BIS-P == * common-name: ** n-acetyl-d-glucosamine 1,6-bisphosphate == Reaction(s) known to consume the compound...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite N-ACETYL-D-GLUCOSAMINE-16-BIS-P == |
* common-name: | * common-name: | ||
− | ** | + | ** n-acetyl-d-glucosamine 1,6-bisphosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-16426]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-16425]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n-acetyl-d-glucosamine 1,6-bisphosphate}} |
− | |||
− |
Revision as of 11:16, 15 January 2021
Contents
Metabolite N-ACETYL-D-GLUCOSAMINE-16-BIS-P
- common-name:
- n-acetyl-d-glucosamine 1,6-bisphosphate