Difference between revisions of "Dermatan-NAcGal-4-sulfates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11495 == * common-name: ** (2-hydroxyphenyl)acetate * smiles: ** c(=o)([o-])cc1(=c(o)c=cc=c1) * inchi-key: ** ccvyrrgzdbshfu-uhfffaoy...")
(Created page with "Category:metabolite == Metabolite Dermatan-NAcGal-4-sulfates == * common-name: ** [dermatan]-4-o-sulfo-n-acetyl-d-galactosamine == Reaction(s) known to consume the compoun...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11495 ==
+
== Metabolite Dermatan-NAcGal-4-sulfates ==
 
* common-name:
 
* common-name:
** (2-hydroxyphenyl)acetate
+
** [dermatan]-4-o-sulfo-n-acetyl-d-galactosamine
* smiles:
 
** c(=o)([o-])cc1(=c(o)c=cc=c1)
 
* inchi-key:
 
** ccvyrrgzdbshfu-uhfffaoysa-m
 
* molecular-weight:
 
** 151.141
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-7953]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10815]]
+
* [[RXN-11555]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2-hydroxyphenyl)acetate}}
+
{{#set: common-name=[dermatan]-4-o-sulfo-n-acetyl-d-galactosamine}}
{{#set: inchi-key=inchikey=ccvyrrgzdbshfu-uhfffaoysa-m}}
 
{{#set: molecular-weight=151.141}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite Dermatan-NAcGal-4-sulfates

  • common-name:
    • [dermatan]-4-o-sulfo-n-acetyl-d-galactosamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "dermatan]-4-o-sulfo-n-acetyl-d-galactosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.