Difference between revisions of "Detyrosinated-alpha--tubulins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12124 == * common-name: ** menaquinol-6 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c...")
(Created page with "Category:metabolite == Metabolite CPD-8900 == * common-name: ** a [protein] n6,n6-dimethyl-l-lysine == Reaction(s) known to consume the compound == * RXN-13186 * RXN...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12124 ==
+
== Metabolite CPD-8900 ==
 
* common-name:
 
* common-name:
** menaquinol-6
+
** a [protein] n6,n6-dimethyl-l-lysine
* smiles:
 
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c
 
* inchi-key:
 
** zventdgzqvbwna-rciygobdsa-n
 
* molecular-weight:
 
** 582.908
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13186]]
 +
* [[RXN-8660]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9220]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menaquinol-6}}
+
{{#set: common-name=a [protein] n6,n6-dimethyl-l-lysine}}
{{#set: inchi-key=inchikey=zventdgzqvbwna-rciygobdsa-n}}
 
{{#set: molecular-weight=582.908}}
 

Revision as of 13:11, 14 January 2021

Metabolite CPD-8900

  • common-name:
    • a [protein] n6,n6-dimethyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein] n6,n6-dimethyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.