Difference between revisions of "Diacyl-3-O-glucl-1-6-gluc-sn-glycerol"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Sec == * common-name: ** a trnasec == Reaction(s) known to consume the compound == * RXN0-2161 == Reaction(s) known to produce t...") |
(Created page with "Category:metabolite == Metabolite CPD-11398 == * common-name: ** l-thyroxine phenolic β-d-glucuronide * smiles: ** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11398 == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-thyroxine phenolic β-d-glucuronide |
| + | * smiles: | ||
| + | ** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3)) | ||
| + | * inchi-key: | ||
| + | ** rghrjbikiyuhev-sgpdefqssa-m | ||
| + | * molecular-weight: | ||
| + | ** 951.992 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10606]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-thyroxine phenolic β-d-glucuronide}} |
| + | {{#set: inchi-key=inchikey=rghrjbikiyuhev-sgpdefqssa-m}} | ||
| + | {{#set: molecular-weight=951.992}} | ||
Revision as of 11:16, 15 January 2021
Contents
Metabolite CPD-11398
- common-name:
- l-thyroxine phenolic β-d-glucuronide
- smiles:
- c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
- inchi-key:
- rghrjbikiyuhev-sgpdefqssa-m
- molecular-weight:
- 951.992
