Difference between revisions of "Diacyl-3-O-glucl-1-6-gluc-sn-glycerol"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18309 == * common-name: ** n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine * smiles: ** cc(c)c(c([o-])=o)nc(=o)c([n+])cn...")
(Created page with "Category:metabolite == Metabolite holo-VibB == * common-name: ** a holo-[vibb aryl-carrier protein] == Reaction(s) known to consume the compound == * RXN-10994 == Reac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-18309 ==
+
== Metabolite holo-VibB ==
 
* common-name:
 
* common-name:
−
** n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine
+
** a holo-[vibb aryl-carrier protein]
−
* smiles:
 
−
** cc(c)c(c([o-])=o)nc(=o)c([n+])cnc(=o)c1(oc(c(=o)n)1)
 
−
* inchi-key:
 
−
** hcgfosjnuodeoh-rulnzfcnsa-n
 
−
* molecular-weight:
 
−
** 316.313
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10994]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-16991]]
+
* [[RXN-10994]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine}}
+
{{#set: common-name=a holo-[vibb aryl-carrier protein]}}
−
{{#set: inchi-key=inchikey=hcgfosjnuodeoh-rulnzfcnsa-n}}
 
−
{{#set: molecular-weight=316.313}}
 

Revision as of 13:10, 14 January 2021

Metabolite holo-VibB

  • common-name:
    • a holo-[vibb aryl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a holo-[vibb aryl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Diacyl-3-O-glucl-1-6-gluc-sn-glycerol&oldid=86115"