Difference between revisions of "Dialkyl-phosphates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DELTA3-ISOPENTENYL-PP == * common-name: ** isopentenyl diphosphate * smiles: ** c=c(c)ccop([o-])(=o)op([o-])(=o)[o-] * inchi-key: ** nuhs...") |
(Created page with "Category:metabolite == Metabolite Dialkyl-phosphates == * common-name: ** a dialkyl phosphate == Reaction(s) known to consume the compound == == Reaction(s) known to produ...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Dialkyl-phosphates == |
* common-name: | * common-name: | ||
− | ** | + | ** a dialkyl phosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ARYLDIALKYLPHOSPHATASE-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a dialkyl phosphate}} |
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite Dialkyl-phosphates
- common-name:
- a dialkyl phosphate