Difference between revisions of "Dialkyl-phosphates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11403 == * common-name: ** tetraiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite Dialkyl-phosphates == * common-name: ** a dialkyl phosphate == Reaction(s) known to consume the compound == == Reaction(s) known to produ...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Dialkyl-phosphates == |
* common-name: | * common-name: | ||
| − | ** | + | ** a dialkyl phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ARYLDIALKYLPHOSPHATASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a dialkyl phosphate}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite Dialkyl-phosphates
- common-name:
- a dialkyl phosphate
