Difference between revisions of "Dietary-retinyl-esters"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite I-antigens == * common-name: ** an i antigen == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound...") |
(Created page with "Category:metabolite == Metabolite CPD-11402 == * common-name: ** 3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide * smiles: ** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11402 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide |
| + | * smiles: | ||
| + | ** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c=c3))) | ||
| + | * inchi-key: | ||
| + | ** lqmbvwcqwfepfk-dkbymcrtsa-m | ||
| + | * molecular-weight: | ||
| + | ** 826.095 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10609]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide}} |
| + | {{#set: inchi-key=inchikey=lqmbvwcqwfepfk-dkbymcrtsa-m}} | ||
| + | {{#set: molecular-weight=826.095}} | ||
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD-11402
- common-name:
- 3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide
- smiles:
- c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c=c3)))
- inchi-key:
- lqmbvwcqwfepfk-dkbymcrtsa-m
- molecular-weight:
- 826.095
