Difference between revisions of "Dodecanoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15424 == * common-name: ** o-carbamoyladenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o * inch...") |
(Created page with "Category:metabolite == Metabolite Dodecanoyl-ACPs == * common-name: ** a dodecanoyl-[acp] == Reaction(s) known to consume the compound == * 3.1.2.21-RXN * RXN-9535...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Dodecanoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a dodecanoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[3.1.2.21-RXN]] |
| − | * [[RXN- | + | * [[RXN-9535]] |
| − | * [[RXN- | + | * [[RXN-9653]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9534]] |
| + | * [[RXN-9661]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a dodecanoyl-[acp]}} |
| − | |||
| − | |||
Revision as of 11:18, 15 January 2021
Contents
Metabolite Dodecanoyl-ACPs
- common-name:
- a dodecanoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a dodecanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
