Difference between revisions of "Donor-H2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18020 == * transcription-direction: ** positive * right-end-position: ** 185208 * left-end-position: ** 163861 * centisome-position: ** 63.923557...")
(Created page with "Category:metabolite == Metabolite CPD-11673 == * common-name: ** 5-hydroxytryptophol glucuronide * smiles: ** c(o)cc1(=cnc3(=c1c=c(oc2(oc(c(=o)o)c(o)c(o)c(o)2))c=c3)) * in...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ18020 ==
+
== Metabolite CPD-11673 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 5-hydroxytryptophol glucuronide
−
* right-end-position:
+
* smiles:
−
** 185208
+
** c(o)cc1(=cnc3(=c1c=c(oc2(oc(c(=o)o)c(o)c(o)c(o)2))c=c3))
−
* left-end-position:
+
* inchi-key:
−
** 163861
+
** nflhlwrxdoxscf-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 63.923557   
+
** 353.328
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-10784]]
−
* [[PHOSGLYPHOS-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=5-hydroxytryptophol glucuronide}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=nflhlwrxdoxscf-uhfffaoysa-n}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=353.328}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* [[PWY66-399]]
 
−
** '''11''' reactions found over '''12''' reactions in the full pathway
 
−
* [[GLUCONEO-PWY]]
 
−
** '''12''' reactions found over '''13''' reactions in the full pathway
 
−
* [[P124-PWY]]
 
−
** '''12''' reactions found over '''15''' reactions in the full pathway
 
−
* [[CALVIN-PWY]]
 
−
** '''12''' reactions found over '''13''' reactions in the full pathway
 
−
* [[P185-PWY]]
 
−
** '''11''' reactions found over '''12''' reactions in the full pathway
 
−
* [[P122-PWY]]
 
−
** '''16''' reactions found over '''18''' reactions in the full pathway
 
−
* [[PWY-5484]]
 
−
** '''10''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-1042]]
 
−
** '''9''' reactions found over '''10''' reactions in the full pathway
 
−
* [[GLYCOLYSIS]]
 
−
** '''11''' reactions found over '''12''' reactions in the full pathway
 
−
* [[ANAGLYCOLYSIS-PWY]]
 
−
** '''10''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-7003]]
 
−
** '''8''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-6901]]
 
−
** '''10''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-6886]]
 
−
** '''8''' reactions found over '''5''' reactions in the full pathway
 
−
* [[SUCSYN-PWY]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
</div>
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=185208}}
 
−
{{#set: left-end-position=163861}}
 
−
{{#set: centisome-position=63.923557    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=14}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-11673

  • common-name:
    • 5-hydroxytryptophol glucuronide
  • smiles:
    • c(o)cc1(=cnc3(=c1c=c(oc2(oc(c(=o)o)c(o)c(o)c(o)2))c=c3))
  • inchi-key:
    • nflhlwrxdoxscf-uhfffaoysa-n
  • molecular-weight:
    • 353.328

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Donor-H2&oldid=46194"