Difference between revisions of "Double-helix-DNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PAPS == * common-name: ** 3'-phosphoadenylyl-sulfate * smiles: ** c(op(=o)([o-])os(=o)(=o)[o-])c1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(...")
(Created page with "Category:metabolite == Metabolite Steryl-Esters == * common-name: ** a steryl-ester == Reaction(s) known to consume the compound == * STEROL-ESTERASE-RXN == Reaction(s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PAPS ==
+
== Metabolite Steryl-Esters ==
 
* common-name:
 
* common-name:
** 3'-phosphoadenylyl-sulfate
+
** a steryl-ester
* smiles:
 
** c(op(=o)([o-])os(=o)(=o)[o-])c1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23)))
 
* inchi-key:
 
** gacdqmdrprgctn-kqynxxcusa-j
 
* molecular-weight:
 
** 503.23
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[STEROL-ESTERASE-RXN]]
* [[1.8.4.8-RXN]]
 
* [[2.8.2.23-RXN]]
 
* [[2.8.2.29-RXN]]
 
* [[2.8.2.30-RXN]]
 
* [[ADENYLYLSULFKIN-RXN]]
 
* [[ARYL-SULFOTRANSFERASE-RXN]]
 
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
 
* [[CHONDROITIN-4-SULFOTRANSFERASE-RXN]]
 
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
 
* [[HEPARITIN-SULFOTRANSFERASE-RXN]]
 
* [[PAPSPAPthr]]
 
* [[R163-RXN]]
 
* [[RXN-10614]]
 
* [[RXN-10615]]
 
* [[RXN-10777]]
 
* [[RXN-10782]]
 
* [[RXN-11058]]
 
* [[RXN-11059]]
 
* [[RXN-11555]]
 
* [[RXN-15587]]
 
* [[RXN-15588]]
 
* [[RXN-15589]]
 
* [[RXN-17203]]
 
* [[RXN-18301]]
 
* [[RXN-18303]]
 
* [[RXN-701]]
 
* [[RXN-7953]]
 
* [[RXN-7954]]
 
* [[RXN6666-9]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.8.4.8-RXN]]
 
* [[ADENYLYLSULFKIN-RXN]]
 
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
 
* [[PAPSPAPthr]]
 
* [[R163-RXN]]
 
* [[RXN-15587]]
 
* [[RXN-15588]]
 
* [[RXN-15589]]
 
* [[RXN-17203]]
 
* [[RXN-701]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3'-phosphoadenylyl-sulfate}}
+
{{#set: common-name=a steryl-ester}}
{{#set: inchi-key=inchikey=gacdqmdrprgctn-kqynxxcusa-j}}
 
{{#set: molecular-weight=503.23}}
 

Revision as of 08:31, 15 March 2021

Metabolite Steryl-Esters

  • common-name:
    • a steryl-ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality