Difference between revisions of "E-PHENYLITACONYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-Ribofuranose == * common-name: ** d-ribofuranose == Reaction(s) known to consume the compound == * RXN-4315 == Reaction(s) known to...")
(Created page with "Category:metabolite == Metabolite E-PHENYLITACONYL-COA == * common-name: ** (e)-2-benzylidenesuccinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(cc(=o)[o-])=cc1(c=...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-Ribofuranose ==
+
== Metabolite E-PHENYLITACONYL-COA ==
 
* common-name:
 
* common-name:
** d-ribofuranose
+
** (e)-2-benzylidenesuccinyl-coa
 +
* smiles:
 +
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(cc(=o)[o-])=cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 +
* inchi-key:
 +
** cizckpngzpendv-umuuvtgisa-i
 +
* molecular-weight:
 +
** 950.677
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4315]]
+
* [[RXN-902]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PURINE-NUCLEOSIDASE-RXN]]
 
* [[RIBOSYLPYRIMIDINE-NUCLEOSIDASE-RXN]]
 
* [[RXN-4315]]
 
* [[RXN0-361]]
 
* [[RXN0-363]]
 
* [[RXN0-366]]
 
* [[URIDINE-NUCLEOSIDASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-ribofuranose}}
+
{{#set: common-name=(e)-2-benzylidenesuccinyl-coa}}
 +
{{#set: inchi-key=inchikey=cizckpngzpendv-umuuvtgisa-i}}
 +
{{#set: molecular-weight=950.677}}

Latest revision as of 11:15, 18 March 2021

Metabolite E-PHENYLITACONYL-COA

  • common-name:
    • (e)-2-benzylidenesuccinyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(cc(=o)[o-])=cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • cizckpngzpendv-umuuvtgisa-i
  • molecular-weight:
    • 950.677

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality