Difference between revisions of "EDTA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19719 == * transcription-direction: ** positive * right-end-position: ** 180530 * left-end-position: ** 162989 * centisome-position: ** 73.356346...")
(Created page with "Category:metabolite == Metabolite EDTA == * common-name: ** edta * smiles: ** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o * inchi-key: ** kcxvzyzypllwcc-uhfff...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ19719 ==
+
== Metabolite EDTA ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** edta
−
* right-end-position:
+
* smiles:
−
** 180530
+
** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 162989
+
** kcxvzyzypllwcc-uhfffaoysa-l
−
* centisome-position:
+
* molecular-weight:
−
** 73.356346   
+
** 290.229
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ExchangeSeed-EDTA]]
−
== Reaction(s) associated ==
+
* [[TransportSeed-EDTA]]
−
* [[DIHYDROXYISOVALDEHYDRAT-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[ExchangeSeed-EDTA]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[TransportSeed-EDTA]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=edta}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=kcxvzyzypllwcc-uhfffaoysa-l}}
−
* [[DIHYDROXYMETVALDEHYDRAT-RXN]]
+
{{#set: molecular-weight=290.229}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[PGLUCONDEHYDRAT-RXN]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-11717]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[VALSYN-PWY]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7111]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[ILEUSYN-PWY]]
 
−
** '''4''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-5101]]
 
−
** '''4''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-5104]]
 
−
** '''2''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-5103]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[ENTNER-DOUDOROFF-PWY]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6627]]
 
−
** '''3''' reactions found over '''15''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=180530}}
 
−
{{#set: left-end-position=162989}}
 
−
{{#set: centisome-position=73.356346    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=8}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite EDTA

  • common-name:
    • edta
  • smiles:
    • c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o
  • inchi-key:
    • kcxvzyzypllwcc-uhfffaoysa-l
  • molecular-weight:
    • 290.229

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=EDTA&oldid=137784"