Difference between revisions of "EDTA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Charged-ALA-tRNAs == * common-name: ** an l-alanyl-[trnaala] == Reaction(s) known to consume the compound == == Reaction(s) known to prod...")
(Created page with "Category:metabolite == Metabolite EDTA == * common-name: ** edta * smiles: ** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o * inchi-key: ** kcxvzyzypllwcc-uhfff...")
 
(4 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Charged-ALA-tRNAs ==
+
== Metabolite EDTA ==
 
* common-name:
 
* common-name:
** an l-alanyl-[trnaala]
+
** edta
 +
* smiles:
 +
** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o
 +
* inchi-key:
 +
** kcxvzyzypllwcc-uhfffaoysa-l
 +
* molecular-weight:
 +
** 290.229
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ExchangeSeed-EDTA]]
 +
* [[TransportSeed-EDTA]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ALANINE--TRNA-LIGASE-RXN]]
+
* [[ExchangeSeed-EDTA]]
 +
* [[TransportSeed-EDTA]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an l-alanyl-[trnaala]}}
+
{{#set: common-name=edta}}
 +
{{#set: inchi-key=inchikey=kcxvzyzypllwcc-uhfffaoysa-l}}
 +
{{#set: molecular-weight=290.229}}

Latest revision as of 11:13, 18 March 2021

Metabolite EDTA

  • common-name:
    • edta
  • smiles:
    • c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o
  • inchi-key:
    • kcxvzyzypllwcc-uhfffaoysa-l
  • molecular-weight:
    • 290.229

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality