Difference between revisions of "EEF-2-Histidines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19158 == * common-name: ** 3-oxo-(9z)-hexadecenoyl-coa * smiles: ** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...")
(Created page with "Category:metabolite == Metabolite eEF-2-Histidines == * common-name: ** an l-histidine-[translation elongation factor 2] == Reaction(s) known to consume the compound == *...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19158 ==
+
== Metabolite eEF-2-Histidines ==
 
* common-name:
 
* common-name:
** 3-oxo-(9z)-hexadecenoyl-coa
+
** an l-histidine-[translation elongation factor 2]
* smiles:
 
** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** jdnargywmlyada-mdmkaecgsa-j
 
* molecular-weight:
 
** 1013.883
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17791]]
+
* [[RXN-11371]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17790]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(9z)-hexadecenoyl-coa}}
+
{{#set: common-name=an l-histidine-[translation elongation factor 2]}}
{{#set: inchi-key=inchikey=jdnargywmlyada-mdmkaecgsa-j}}
 
{{#set: molecular-weight=1013.883}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite eEF-2-Histidines

  • common-name:
    • an l-histidine-[translation elongation factor 2]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-histidine-[translation elongation factor 2" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.