Difference between revisions of "EIF5A-LYSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15655 == * common-name: ** (3e)-undec-3-enoyl-coa * smiles: ** cccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...")
(Created page with "Category:metabolite == Metabolite EIF5A-LYSINE == * common-name: ** an [eif5a-precursor]-lysine == Reaction(s) known to consume the compound == * 2.5.1.46-RXN * RXN-...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15655 ==
+
== Metabolite EIF5A-LYSINE ==
 
* common-name:
 
* common-name:
** (3e)-undec-3-enoyl-coa
+
** an [eif5a-precursor]-lysine
* smiles:
 
** cccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** hvxccjiyxizgop-nadloitosa-j
 
* molecular-weight:
 
** 929.765
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.5.1.46-RXN]]
 +
* [[RXN-13416]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14776]]
 
* [[RXN-14790]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3e)-undec-3-enoyl-coa}}
+
{{#set: common-name=an [eif5a-precursor]-lysine}}
{{#set: inchi-key=inchikey=hvxccjiyxizgop-nadloitosa-j}}
 
{{#set: molecular-weight=929.765}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite EIF5A-LYSINE

  • common-name:
    • an [eif5a-precursor]-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [eif5a-precursor]-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.