Difference between revisions of "ENOL-OXALOACETATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11517 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccccc(sccnc(=o)c...")
(Created page with "Category:metabolite == Metabolite ENOL-OXALOACETATE == * common-name: ** enol-oxaloacetate * smiles: ** c([o-])(=o)c(o)=cc(=o)[o-] * inchi-key: ** uwyvpfmhmjibhe-uphrsurjs...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11517 ==
+
== Metabolite ENOL-OXALOACETATE ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-coa
+
** enol-oxaloacetate
 
* smiles:
 
* smiles:
** ccc=ccc1(c(ccc(=o)1)cccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
+
** c([o-])(=o)c(o)=cc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** jziqdjlbfktbak-llhoyasasa-j
+
** uwyvpfmhmjibhe-uphrsurjsa-l
 
* molecular-weight:
 
* molecular-weight:
** 1039.92
+
** 130.057
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10696]]
+
* [[OXALOACETATE-TAUTOMERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-coa}}
+
{{#set: common-name=enol-oxaloacetate}}
{{#set: inchi-key=inchikey=jziqdjlbfktbak-llhoyasasa-j}}
+
{{#set: inchi-key=inchikey=uwyvpfmhmjibhe-uphrsurjsa-l}}
{{#set: molecular-weight=1039.92}}
+
{{#set: molecular-weight=130.057}}

Latest revision as of 11:14, 18 March 2021

Metabolite ENOL-OXALOACETATE

  • common-name:
    • enol-oxaloacetate
  • smiles:
    • c([o-])(=o)c(o)=cc(=o)[o-]
  • inchi-key:
    • uwyvpfmhmjibhe-uphrsurjsa-l
  • molecular-weight:
    • 130.057

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality