Difference between revisions of "ENOL-OXALOACETATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Cyclic-3-5-Nucleoside-Monophosphates == * common-name: ** a nucleoside cyclic 3',5'-monophosphate == Reaction(s) known to consume the com...")
(Created page with "Category:metabolite == Metabolite ENOL-OXALOACETATE == * common-name: ** enol-oxaloacetate * smiles: ** c([o-])(=o)c(o)=cc(=o)[o-] * inchi-key: ** uwyvpfmhmjibhe-uphrsurjs...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Cyclic-3-5-Nucleoside-Monophosphates ==
+
== Metabolite ENOL-OXALOACETATE ==
 
* common-name:
 
* common-name:
** a nucleoside cyclic 3',5'-monophosphate
+
** enol-oxaloacetate
 +
* smiles:
 +
** c([o-])(=o)c(o)=cc(=o)[o-]
 +
* inchi-key:
 +
** uwyvpfmhmjibhe-uphrsurjsa-l
 +
* molecular-weight:
 +
** 130.057
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.4.17-RXN]]
+
* [[OXALOACETATE-TAUTOMERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a nucleoside cyclic 3',5'-monophosphate}}
+
{{#set: common-name=enol-oxaloacetate}}
 +
{{#set: inchi-key=inchikey=uwyvpfmhmjibhe-uphrsurjsa-l}}
 +
{{#set: molecular-weight=130.057}}

Latest revision as of 11:14, 18 March 2021

Metabolite ENOL-OXALOACETATE

  • common-name:
    • enol-oxaloacetate
  • smiles:
    • c([o-])(=o)c(o)=cc(=o)[o-]
  • inchi-key:
    • uwyvpfmhmjibhe-uphrsurjsa-l
  • molecular-weight:
    • 130.057

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality