Difference between revisions of "ENT-KAUR-16-EN-19-OL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CHORISMATE == * common-name: ** chorismate * smiles: ** c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1) * inchi-key: ** wtfxtqvdakgdey-htqzyqbo...") |
(Created page with "Category:metabolite == Metabolite ENT-KAUR-16-EN-19-OL == * common-name: ** ent-kaurenol * smiles: ** c=c1(c4(cc3(c1)(cc[ch]2(c(c)(co)cccc(c)2[ch]3cc4)))) * inchi-key: **...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ENT-KAUR-16-EN-19-OL == |
* common-name: | * common-name: | ||
− | ** | + | ** ent-kaurenol |
* smiles: | * smiles: | ||
− | ** c= | + | ** c=c1(c4(cc3(c1)(cc[ch]2(c(c)(co)cccc(c)2[ch]3cc4)))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** tujqvrfwmwrmio-xrnrsjmdsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 288.472 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-5242]] |
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.14.13.78-RXN]] |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ent-kaurenol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=tujqvrfwmwrmio-xrnrsjmdsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=288.472}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite ENT-KAUR-16-EN-19-OL
- common-name:
- ent-kaurenol
- smiles:
- c=c1(c4(cc3(c1)(cc[ch]2(c(c)(co)cccc(c)2[ch]3cc4))))
- inchi-key:
- tujqvrfwmwrmio-xrnrsjmdsa-n
- molecular-weight:
- 288.472