Difference between revisions of "ENT-KAUR-16-EN-19-OL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CHORISMATE == * common-name: ** chorismate * smiles: ** c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1) * inchi-key: ** wtfxtqvdakgdey-htqzyqbo...")
(Created page with "Category:metabolite == Metabolite ENT-KAUR-16-EN-19-OL == * common-name: ** ent-kaurenol * smiles: ** c=c1(c4(cc3(c1)(cc[ch]2(c(c)(co)cccc(c)2[ch]3cc4)))) * inchi-key: **...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CHORISMATE ==
+
== Metabolite ENT-KAUR-16-EN-19-OL ==
 
* common-name:
 
* common-name:
** chorismate
+
** ent-kaurenol
 
* smiles:
 
* smiles:
** c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1)
+
** c=c1(c4(cc3(c1)(cc[ch]2(c(c)(co)cccc(c)2[ch]3cc4))))
 
* inchi-key:
 
* inchi-key:
** wtfxtqvdakgdey-htqzyqbosa-l
+
** tujqvrfwmwrmio-xrnrsjmdsa-n
 
* molecular-weight:
 
* molecular-weight:
** 224.17
+
** 288.472
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ANTHRANSYN-RXN]]
+
* [[RXN-5242]]
* [[CHORISMATEMUT-RXN]]
 
* [[ISOCHORSYN-RXN]]
 
* [[PABASYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ANTHRANSYN-RXN]]
+
* [[1.14.13.78-RXN]]
* [[CHORISMATE-SYNTHASE-RXN]]
 
* [[CHORISMATEMUT-RXN]]
 
* [[ISOCHORSYN-RXN]]
 
* [[PABASYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=chorismate}}
+
{{#set: common-name=ent-kaurenol}}
{{#set: inchi-key=inchikey=wtfxtqvdakgdey-htqzyqbosa-l}}
+
{{#set: inchi-key=inchikey=tujqvrfwmwrmio-xrnrsjmdsa-n}}
{{#set: molecular-weight=224.17}}
+
{{#set: molecular-weight=288.472}}

Latest revision as of 11:17, 18 March 2021

Metabolite ENT-KAUR-16-EN-19-OL

  • common-name:
    • ent-kaurenol
  • smiles:
    • c=c1(c4(cc3(c1)(cc[ch]2(c(c)(co)cccc(c)2[ch]3cc4))))
  • inchi-key:
    • tujqvrfwmwrmio-xrnrsjmdsa-n
  • molecular-weight:
    • 288.472

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality