Difference between revisions of "ENT-KAUR-16-EN-19-OL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CHORISMATE == * common-name: ** chorismate * smiles: ** c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1) * inchi-key: ** wtfxtqvdakgdey-htqzyqbo...")
(Created page with "Category:metabolite == Metabolite 3-hydroxy-L-asparagine-HIF-Alpha == * common-name: ** a (3s)-3-hydroxy-l-asparagine-hif α subunit == Reaction(s) known to consume t...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CHORISMATE ==
+
== Metabolite 3-hydroxy-L-asparagine-HIF-Alpha ==
 
* common-name:
 
* common-name:
** chorismate
+
** a (3s)-3-hydroxy-l-asparagine-hif α subunit
* smiles:
 
** c=c(c(=o)[o-])oc1(c(o)c=cc(c([o-])=o)=c1)
 
* inchi-key:
 
** wtfxtqvdakgdey-htqzyqbosa-l
 
* molecular-weight:
 
** 224.17
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ANTHRANSYN-RXN]]
 
* [[CHORISMATEMUT-RXN]]
 
* [[ISOCHORSYN-RXN]]
 
* [[PABASYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ANTHRANSYN-RXN]]
+
* [[RXN-11321]]
* [[CHORISMATE-SYNTHASE-RXN]]
 
* [[CHORISMATEMUT-RXN]]
 
* [[ISOCHORSYN-RXN]]
 
* [[PABASYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=chorismate}}
+
{{#set: common-name=a (3s)-3-hydroxy-l-asparagine-hif α subunit}}
{{#set: inchi-key=inchikey=wtfxtqvdakgdey-htqzyqbosa-l}}
 
{{#set: molecular-weight=224.17}}
 

Revision as of 15:30, 5 January 2021

Metabolite 3-hydroxy-L-asparagine-HIF-Alpha

  • common-name:
    • a (3s)-3-hydroxy-l-asparagine-hif α subunit

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality