Difference between revisions of "EPOXYSQUALENE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-23714 == == Reaction(s) known to consume the compound == * RXN-21835 == Reaction(s) known to produce the compound == * RXN-2183...")
(Created page with "Category:metabolite == Metabolite CPD1G-120 == * common-name: ** deacetylmycothiol * smiles: ** c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o) * inchi-k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-23714 ==
+
== Metabolite CPD1G-120 ==
 +
* common-name:
 +
** deacetylmycothiol
 +
* smiles:
 +
** c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o)
 +
* inchi-key:
 +
** zgxscmbzzvxwgf-bseffjthsa-o
 +
* molecular-weight:
 +
** 445.461
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-21835]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-21834]]
+
* [[RXN1G-121]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=deacetylmycothiol}}
 +
{{#set: inchi-key=inchikey=zgxscmbzzvxwgf-bseffjthsa-o}}
 +
{{#set: molecular-weight=445.461}}

Revision as of 11:19, 15 January 2021

Metabolite CPD1G-120

  • common-name:
    • deacetylmycothiol
  • smiles:
    • c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o)
  • inchi-key:
    • zgxscmbzzvxwgf-bseffjthsa-o
  • molecular-weight:
    • 445.461

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality