Difference between revisions of "EPOXYSQUALENE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1812 == * common-name: ** 2-oleoylglycerol * smiles: ** ccccccccc=ccccccccc(=o)oc(co)co * inchi-key: ** upwgqkdvauruge-ktkrtigzsa-n...") |
(Created page with "Category:metabolite == Metabolite EPOXYSQUALENE == * common-name: ** (3s)-2,3-epoxy-2,3-dihydrosqualene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)cc[ch]1(c(c)(c)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite EPOXYSQUALENE == |
* common-name: | * common-name: | ||
− | ** 2- | + | ** (3s)-2,3-epoxy-2,3-dihydrosqualene |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)cc[ch]1(c(c)(c)o1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qyimspsdbykppy-rskuxysasa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 426.724 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[CYCLOARTENOL-SYNTHASE-RXN]] |
− | * [[RXN | + | * [[LANOSTEROL-SYNTHASE-RXN]] |
− | * [[ | + | * [[SMO]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[SMO]] | ||
+ | * [[SQUALENE-MONOOXYGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=2- | + | {{#set: common-name=(3s)-2,3-epoxy-2,3-dihydrosqualene}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qyimspsdbykppy-rskuxysasa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=426.724}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite EPOXYSQUALENE
- common-name:
- (3s)-2,3-epoxy-2,3-dihydrosqualene
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)cc[ch]1(c(c)(c)o1)
- inchi-key:
- qyimspsdbykppy-rskuxysasa-n
- molecular-weight:
- 426.724