Difference between revisions of "EPOXYSQUALENE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-36 == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine * smiles: ** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(...")
(Created page with "Category:metabolite == Metabolite EPOXYSQUALENE == * common-name: ** (3s)-2,3-epoxy-2,3-dihydrosqualene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)cc[ch]1(c(c)(c)...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-36 ==
+
== Metabolite EPOXYSQUALENE ==
 
* common-name:
 
* common-name:
** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine
+
** (3s)-2,3-epoxy-2,3-dihydrosqualene
 
* smiles:
 
* smiles:
** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
+
** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)cc[ch]1(c(c)(c)o1)
 
* inchi-key:
 
* inchi-key:
** dlgjwsvwtwewbj-ztvljyeesa-m
+
** qyimspsdbykppy-rskuxysasa-n
 
* molecular-weight:
 
* molecular-weight:
** 378.312
+
** 426.724
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12178]]
+
* [[CYCLOARTENOL-SYNTHASE-RXN]]
 +
* [[LANOSTEROL-SYNTHASE-RXN]]
 +
* [[SMO]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[SMO]]
 +
* [[SQUALENE-MONOOXYGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine}}
+
{{#set: common-name=(3s)-2,3-epoxy-2,3-dihydrosqualene}}
{{#set: inchi-key=inchikey=dlgjwsvwtwewbj-ztvljyeesa-m}}
+
{{#set: inchi-key=inchikey=qyimspsdbykppy-rskuxysasa-n}}
{{#set: molecular-weight=378.312}}
+
{{#set: molecular-weight=426.724}}

Latest revision as of 11:17, 18 March 2021

Metabolite EPOXYSQUALENE

  • common-name:
    • (3s)-2,3-epoxy-2,3-dihydrosqualene
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)cc[ch]1(c(c)(c)o1)
  • inchi-key:
    • qyimspsdbykppy-rskuxysasa-n
  • molecular-weight:
    • 426.724

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality