Difference between revisions of "EPOXYSQUALENE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-36 == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine * smiles: ** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(...")
(Created page with "Category:metabolite == Metabolite CPD-160 == * common-name: ** a phosphatidyl-n-dimethylethanolamine == Reaction(s) known to consume the compound == * RXN4FS-2 == Reac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-36 ==
+
== Metabolite CPD-160 ==
 
* common-name:
 
* common-name:
** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine
+
** a phosphatidyl-n-dimethylethanolamine
* smiles:
 
** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
 
* inchi-key:
 
** dlgjwsvwtwewbj-ztvljyeesa-m
 
* molecular-weight:
 
** 378.312
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12178]]
+
* [[RXN4FS-2]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.1.1.71-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine}}
+
{{#set: common-name=a phosphatidyl-n-dimethylethanolamine}}
{{#set: inchi-key=inchikey=dlgjwsvwtwewbj-ztvljyeesa-m}}
 
{{#set: molecular-weight=378.312}}
 

Revision as of 14:59, 5 January 2021

Metabolite CPD-160

  • common-name:
    • a phosphatidyl-n-dimethylethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality