Difference between revisions of "ERGOSTEROL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 16S-rRNA-N3-methyluracil1498 == * common-name: ** an n3-methyluracil1498 in 16s rrna == Reaction(s) known to consume the compound == == R...")
(Created page with "Category:metabolite == Metabolite CPD-7224 == * common-name: ** n-acetyl-l-citrulline * smiles: ** cc(=o)nc(c([o-])=o)cccnc(=o)n * inchi-key: ** wmqmioyqxnrroc-lurjtmiesa-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 16S-rRNA-N3-methyluracil1498 ==
+
== Metabolite CPD-7224 ==
 
* common-name:
 
* common-name:
** an n3-methyluracil1498 in 16s rrna
+
** n-acetyl-l-citrulline
 +
* smiles:
 +
** cc(=o)nc(c([o-])=o)cccnc(=o)n
 +
* inchi-key:
 +
** wmqmioyqxnrroc-lurjtmiesa-m
 +
* molecular-weight:
 +
** 216.216
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-7933]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11598]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n3-methyluracil1498 in 16s rrna}}
+
{{#set: common-name=n-acetyl-l-citrulline}}
 +
{{#set: inchi-key=inchikey=wmqmioyqxnrroc-lurjtmiesa-m}}
 +
{{#set: molecular-weight=216.216}}

Revision as of 13:13, 14 January 2021

Metabolite CPD-7224

  • common-name:
    • n-acetyl-l-citrulline
  • smiles:
    • cc(=o)nc(c([o-])=o)cccnc(=o)n
  • inchi-key:
    • wmqmioyqxnrroc-lurjtmiesa-m
  • molecular-weight:
    • 216.216

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality