Difference between revisions of "ERYTHROSE-4P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-187 == * common-name: ** 4-hydroxy-4-methyl-2-oxoglutarate == Reaction(s) known to consume the compound == == Reaction(s) known to pr...") |
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ == * common-name: ** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=ccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol |
| + | * smiles: | ||
| + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** hdsgdgslnmimku-kfsstaeesa-n | ||
| + | * molecular-weight: | ||
| + | ** 699.111 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol}} |
| + | {{#set: inchi-key=inchikey=hdsgdgslnmimku-kfsstaeesa-n}} | ||
| + | {{#set: molecular-weight=699.111}} | ||
Revision as of 18:58, 14 January 2021
Contents
Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ
- common-name:
- 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c
- inchi-key:
- hdsgdgslnmimku-kfsstaeesa-n
- molecular-weight:
- 699.111
