Difference between revisions of "ERYTHROSE-4P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ == * common-name: ** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=ccc...")
(Created page with "Category:metabolite == Metabolite CPD-388 == * common-name: ** pentadecanal * smiles: ** cccccccccccccc[ch]=o * inchi-key: ** xgqjzncfdlxsij-uhfffaoysa-n * molecular-weigh...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ ==
+
== Metabolite CPD-388 ==
 
* common-name:
 
* common-name:
** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
+
** pentadecanal
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c
+
** cccccccccccccc[ch]=o
 
* inchi-key:
 
* inchi-key:
** hdsgdgslnmimku-kfsstaeesa-n
+
** xgqjzncfdlxsij-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 699.111
+
** 226.401
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
+
* [[FATTY-ACID-PEROXIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=pentadecanal}}
{{#set: inchi-key=inchikey=hdsgdgslnmimku-kfsstaeesa-n}}
+
{{#set: inchi-key=inchikey=xgqjzncfdlxsij-uhfffaoysa-n}}
{{#set: molecular-weight=699.111}}
+
{{#set: molecular-weight=226.401}}

Revision as of 11:19, 15 January 2021

Metabolite CPD-388

  • common-name:
    • pentadecanal
  • smiles:
    • cccccccccccccc[ch]=o
  • inchi-key:
    • xgqjzncfdlxsij-uhfffaoysa-n
  • molecular-weight:
    • 226.401

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality